C14H11BrF2N2O — CID 60703391
2-anilino-N-(2-bromo-4,6-difluorophenyl)acetamide (PubChem CID 60703391) has the molecular formula C14H11BrF2N2O and a molecular weight of 341.16 g/mol. Its IUPAC name is 2-anilino-N-(2-bromo-4,6-difluorophenyl)acetamide.
| Compound Name | 2-anilino-N-(2-bromo-4,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 60703391 |
| Molecular Formula | C14H11BrF2N2O |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-anilino-N-(2-bromo-4,6-difluorophenyl)acetamide |
| SMILES | O=C(CNc1ccccc1)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C14H11BrF2N2O/c15-11-6-9(16)7-12(17)14(11)19-13(20)8-18-10-4-2-1-3-5-10/h1-7,18H,8H2,(H,19,20) |
| InChIKey | CAZQGFJQHYKQSG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |