C11H9BrF2N2O — CID 112722692
N-(2-bromo-4,6-difluorophenyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 112722692) has the molecular formula C11H9BrF2N2O and a molecular weight of 303.11 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 112722692 |
| Molecular Formula | C11H9BrF2N2O |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H9BrF2N2O/c1-2-3-15-6-10(17)16-11-8(12)4-7(13)5-9(11)14/h1,4-5,15H,3,6H2,(H,16,17) |
| InChIKey | KXXVLNSNXYQWQB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|