C10H9Br2F2NO — CID 62854822
2-bromo-N-(2-bromo-4,6-difluorophenyl)butanamide (PubChem CID 62854822) has the molecular formula C10H9Br2F2NO and a molecular weight of 356.99 g/mol. Its IUPAC name is 2-bromo-N-(2-bromo-4,6-difluorophenyl)butanamide.
| Compound Name | 2-bromo-N-(2-bromo-4,6-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 62854822 |
| Molecular Formula | C10H9Br2F2NO |
| Molecular Weight | 356.99 g/mol |
| Exact Mass | 354.90 |
| IUPAC Name | 2-bromo-N-(2-bromo-4,6-difluorophenyl)butanamide |
| SMILES | CCC(Br)C(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H9Br2F2NO/c1-2-6(11)10(16)15-9-7(12)3-5(13)4-8(9)14/h3-4,6H,2H2,1H3,(H,15,16) |
| InChIKey | CBQNXRACCSEKMT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|