C7H5BrF2N2O — CID 43347715
(2-bromo-4,6-difluorophenyl)urea (PubChem CID 43347715) has the molecular formula C7H5BrF2N2O and a molecular weight of 251.03 g/mol. Its IUPAC name is (2-bromo-4,6-difluorophenyl)urea.
| Compound Name | (2-bromo-4,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 43347715 |
| Molecular Formula | C7H5BrF2N2O |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | (2-bromo-4,6-difluorophenyl)urea |
| SMILES | NC(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C7H5BrF2N2O/c8-4-1-3(9)2-5(10)6(4)12-7(11)13/h1-2H,(H3,11,12,13) |
| InChIKey | YSRYRTNCSLCCOT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |