C18H19N3O4S — CID 166421162
N-[4-[2-[3-(methanesulfonamido)anilino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166421162) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[4-[2-[3-(methanesulfonamido)anilino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[3-(methanesulfonamido)anilino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421162 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[4-[2-[3-(methanesulfonamido)anilino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)Nc2cccc(NS(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c1-3-17(22)19-14-9-7-13(8-10-14)11-18(23)20-15-5-4-6-16(12-15)21-26(2,24)25/h3-10,12,21H,1,11H2,2H3,(H,19,22)(H,20,23) |
| InChIKey | KQOSVISKGHGEEN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|