C13H14N4O — CID 170699202
N-[4-[(4-aminopyrazol-1-yl)methyl]phenyl]prop-2-enamide (PubChem CID 170699202) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[4-[(4-aminopyrazol-1-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(4-aminopyrazol-1-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170699202 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[4-[(4-aminopyrazol-1-yl)methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Cn2cc(N)cn2)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-2-13(18)16-12-5-3-10(4-6-12)8-17-9-11(14)7-15-17/h2-7,9H,1,8,14H2,(H,16,18) |
| InChIKey | IEWDBDNLUTWGDU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|