C26H26ClN7O3S — CID 170699264
N-[4-[[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]pyrazol-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 170699264) has the molecular formula C26H26ClN7O3S and a molecular weight of 552.06 g/mol. Its IUPAC name is N-[4-[[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]pyrazol-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]pyrazol-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170699264 |
| Molecular Formula | C26H26ClN7O3S |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | N-[4-[[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]pyrazol-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Cn2cc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)C(C)C)n3)cn2)cc1 |
| InChI | InChI=1S/C26H26ClN7O3S/c1-4-24(35)30-19-11-9-18(10-12-19)15-34-16-20(13-29-34)31-26-28-14-21(27)25(33-26)32-22-7-5-6-8-23(22)38(36,37)17(2)3/h4-14,16-17H,1,15H2,2-3H3,(H,30,35)(H2,28,31,32,33) |
| InChIKey | JJEBKMXQGKKGBW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|