C22H22ClN5O4S — CID 164615089
(E)-3-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 164615089) has the molecular formula C22H22ClN5O4S and a molecular weight of 487.97 g/mol. Its IUPAC name is (E)-3-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 164615089 |
| Molecular Formula | C22H22ClN5O4S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | (E)-3-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(/C=C/C(=O)NO)cc2)ncc1Cl |
| InChI | InChI=1S/C22H22ClN5O4S/c1-14(2)33(31,32)19-6-4-3-5-18(19)26-21-17(23)13-24-22(27-21)25-16-10-7-15(8-11-16)9-12-20(29)28-30/h3-14,30H,1-2H3,(H,28,29)(H2,24,25,26,27)/b12-9+ |
| InChIKey | KFBPAJHSLZYIEL-FMIVXFBMSA-N |
| XLogP | 4.32 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|