C26H24ClN5O3S — CID 175186504
N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 175186504) has the molecular formula C26H24ClN5O3S and a molecular weight of 522.03 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 175186504 |
| Molecular Formula | C26H24ClN5O3S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2cccc(NC(=O)c3ccccc3)c2)ncc1Cl |
| InChI | InChI=1S/C26H24ClN5O3S/c1-17(2)36(34,35)23-14-7-6-13-22(23)31-24-21(27)16-28-26(32-24)30-20-12-8-11-19(15-20)29-25(33)18-9-4-3-5-10-18/h3-17H,1-2H3,(H,29,33)(H2,28,30,31,32) |
| InChIKey | DYQQVUCHUIBHJR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |