C20H19ClN4O4S — CID 155549635
4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]benzoic acid (PubChem CID 155549635) has the molecular formula C20H19ClN4O4S and a molecular weight of 446.92 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 155549635 |
| Molecular Formula | C20H19ClN4O4S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]benzoic acid |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)O)cc2)ncc1Cl |
| InChI | InChI=1S/C20H19ClN4O4S/c1-12(2)30(28,29)17-6-4-3-5-16(17)24-18-15(21)11-22-20(25-18)23-14-9-7-13(8-10-14)19(26)27/h3-12H,1-2H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | VICDENMSYNCVKZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |