C20H22ClN5O2S — CID 172857647
2-[(2-anilino-5-chloropyrimidin-4-yl)amino]-N-butan-2-ylbenzenesulfonamide (PubChem CID 172857647) has the molecular formula C20H22ClN5O2S and a molecular weight of 431.95 g/mol. Its IUPAC name is 2-[(2-anilino-5-chloropyrimidin-4-yl)amino]-N-butan-2-ylbenzenesulfonamide.
| Compound Name | 2-[(2-anilino-5-chloropyrimidin-4-yl)amino]-N-butan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 172857647 |
| Molecular Formula | C20H22ClN5O2S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[(2-anilino-5-chloropyrimidin-4-yl)amino]-N-butan-2-ylbenzenesulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccccc1Nc1nc(Nc2ccccc2)ncc1Cl |
| InChI | InChI=1S/C20H22ClN5O2S/c1-3-14(2)26-29(27,28)18-12-8-7-11-17(18)24-19-16(21)13-22-20(25-19)23-15-9-5-4-6-10-15/h4-14,26H,3H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | YXVJULQPAGIBKB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |