C31H42ClN7O3S — CID 59737770
2-[[5-chloro-2-[2-ethoxy-4-(4-piperidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide (PubChem CID 59737770) has the molecular formula C31H42ClN7O3S and a molecular weight of 628.24 g/mol. Its IUPAC name is 2-[[5-chloro-2-[2-ethoxy-4-(4-piperidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-[[5-chloro-2-[2-ethoxy-4-(4-piperidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59737770 |
| Molecular Formula | C31H42ClN7O3S |
| Molecular Weight | 628.24 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 2-[[5-chloro-2-[2-ethoxy-4-(4-piperidin-1-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCOc1cc(N2CCC(N3CCCCC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)NC(C)C)n1 |
| InChI | InChI=1S/C31H42ClN7O3S/c1-4-42-28-20-24(39-18-14-23(15-19-39)38-16-8-5-9-17-38)12-13-26(28)35-31-33-21-25(32)30(36-31)34-27-10-6-7-11-29(27)43(40,41)37-22(2)3/h6-7,10-13,20-23,37H,4-5,8-9,14-19H2,1-3H3,(H2,33,34,35,36) |
| InChIKey | UOVGCIPJUMDOOJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.24 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|