C27H36ClN7O3S — CID 58235627
2-[[5-chloro-2-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 58235627) has the molecular formula C27H36ClN7O3S and a molecular weight of 574.15 g/mol. Its IUPAC name is 2-[[5-chloro-2-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 2-[[5-chloro-2-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58235627 |
| Molecular Formula | C27H36ClN7O3S |
| Molecular Weight | 574.15 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 2-[[5-chloro-2-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CCOc1cc(N2CCN(C)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C27H36ClN7O3S/c1-5-38-24-16-20(35-14-12-34(4)13-15-35)10-11-22(24)32-27-29-18-21(28)26(33-27)31-23-8-6-7-9-25(23)39(36,37)30-17-19(2)3/h6-11,16,18-19,30H,5,12-15,17H2,1-4H3,(H2,29,31,32,33) |
| InChIKey | ZYKBOAOPPMOANM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.15 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|