C24H29ClN6O3S — CID 59737649
2-[[5-chloro-2-[2-ethoxy-4-[(3R)-3-methylpyrrolidin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide (PubChem CID 59737649) has the molecular formula C24H29ClN6O3S and a molecular weight of 517.06 g/mol. Its IUPAC name is 2-[[5-chloro-2-[2-ethoxy-4-[(3R)-3-methylpyrrolidin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-[[5-chloro-2-[2-ethoxy-4-[(3R)-3-methylpyrrolidin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 59737649 |
| Molecular Formula | C24H29ClN6O3S |
| Molecular Weight | 517.06 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-[[5-chloro-2-[2-ethoxy-4-[(3R)-3-methylpyrrolidin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| SMILES | CCOc1cc(N2CC[C@@H](C)C2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)NC)n1 |
| InChI | InChI=1S/C24H29ClN6O3S/c1-4-34-21-13-17(31-12-11-16(2)15-31)9-10-19(21)29-24-27-14-18(25)23(30-24)28-20-7-5-6-8-22(20)35(32,33)26-3/h5-10,13-14,16,26H,4,11-12,15H2,1-3H3,(H2,27,28,29,30)/t16-/m1/s1 |
| InChIKey | MBAFCWOWSAVQCT-MRXNPFEDSA-N |
| XLogP | 4.77 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|