C23H28N6O4S — CID 11698740
2-[[2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide (PubChem CID 11698740) has the molecular formula C23H28N6O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 2-[[2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-[[2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11698740 |
| Molecular Formula | C23H28N6O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-[[2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| SMILES | CCOc1cc(N2CCOCC2)ccc1Nc1nccc(Nc2ccccc2S(=O)(=O)NC)n1 |
| InChI | InChI=1S/C23H28N6O4S/c1-3-33-20-16-17(29-12-14-32-15-13-29)8-9-18(20)27-23-25-11-10-22(28-23)26-19-6-4-5-7-21(19)34(30,31)24-2/h4-11,16,24H,3,12-15H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | DHLQJVQAHPNMJD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|