C26H32BrN5O4S — CID 58235779
5-bromo-4-N-(2-butylsulfonylphenyl)-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 58235779) has the molecular formula C26H32BrN5O4S and a molecular weight of 590.54 g/mol. Its IUPAC name is 5-bromo-4-N-(2-butylsulfonylphenyl)-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(2-butylsulfonylphenyl)-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58235779 |
| Molecular Formula | C26H32BrN5O4S |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 5-bromo-4-N-(2-butylsulfonylphenyl)-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCCS(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)cc2OCC)ncc1Br |
| InChI | InChI=1S/C26H32BrN5O4S/c1-3-5-16-37(33,34)24-9-7-6-8-22(24)29-25-20(27)18-28-26(31-25)30-21-11-10-19(17-23(21)36-4-2)32-12-14-35-15-13-32/h6-11,17-18H,3-5,12-16H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | MDCVJZSTZBXGDN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|