C30H39ClN6O6S — CID 163276236
3-[2-[2-[4-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethoxy]ethoxy]propanoic acid (PubChem CID 163276236) has the molecular formula C30H39ClN6O6S and a molecular weight of 647.20 g/mol. Its IUPAC name is 3-[2-[2-[4-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[4-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 163276236 |
| Molecular Formula | C30H39ClN6O6S |
| Molecular Weight | 647.20 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | 3-[2-[2-[4-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethoxy]ethoxy]propanoic acid |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCN(CCOCCOCCC(=O)O)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C30H39ClN6O6S/c1-22(2)44(40,41)27-6-4-3-5-26(27)34-29-25(31)21-32-30(35-29)33-23-7-9-24(10-8-23)37-14-12-36(13-15-37)16-18-43-20-19-42-17-11-28(38)39/h3-10,21-22H,11-20H2,1-2H3,(H,38,39)(H2,32,33,34,35) |
| InChIKey | NPDGCQMXMIYZFD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 146.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.20 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|