C30H38ClN7O3S — CID 158649419
N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methyl-2-(4-propylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 158649419) has the molecular formula C30H38ClN7O3S and a molecular weight of 612.20 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methyl-2-(4-propylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methyl-2-(4-propylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 158649419 |
| Molecular Formula | C30H38ClN7O3S |
| Molecular Weight | 612.20 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methyl-2-(4-propylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(C)cc1N1CCN(CCC)CC1 |
| InChI | InChI=1S/C30H38ClN7O3S/c1-6-12-37-13-15-38(16-14-37)26-17-21(5)24(18-25(26)33-28(39)7-2)35-30-32-19-22(31)29(36-30)34-23-10-8-9-11-27(23)42(40,41)20(3)4/h7-11,17-20H,2,6,12-16H2,1,3-5H3,(H,33,39)(H2,32,34,35,36) |
| InChIKey | IUFLXVFLQFSZTM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.20 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|