C32H41ClN8O3S — CID 129281617
N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide (PubChem CID 129281617) has the molecular formula C32H41ClN8O3S and a molecular weight of 653.25 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129281617 |
| Molecular Formula | C32H41ClN8O3S |
| Molecular Weight | 653.25 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)ccc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C32H41ClN8O3S/c1-5-30(42)36-27-20-23(10-11-28(27)41-14-12-24(13-15-41)40-18-16-39(4)17-19-40)35-32-34-21-25(33)31(38-32)37-26-8-6-7-9-29(26)45(43,44)22(2)3/h5-11,20-22,24H,1,12-19H2,2-4H3,(H,36,42)(H2,34,35,37,38) |
| InChIKey | KDOSCUJNMXCLKQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|