C23H30ClN7O — CID 167164352
N-[5-[(5-chloropyrimidin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide (PubChem CID 167164352) has the molecular formula C23H30ClN7O and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[5-[(5-chloropyrimidin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[5-[(5-chloropyrimidin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167164352 |
| Molecular Formula | C23H30ClN7O |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[5-[(5-chloropyrimidin-2-yl)amino]-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)cn2)ccc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C23H30ClN7O/c1-3-22(32)28-20-14-18(27-23-25-15-17(24)16-26-23)4-5-21(20)31-8-6-19(7-9-31)30-12-10-29(2)11-13-30/h3-5,14-16,19H,1,6-13H2,2H3,(H,28,32)(H,25,26,27) |
| InChIKey | LVOFKDZXLACHIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|