C26H31ClF2N6O4 — CID 170370268
N-[5-[[4-[[(3S,3aS,6aR)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-[4-(dimethylamino)piperidin-1-yl]phenyl]prop-2-enamide (PubChem CID 170370268) has the molecular formula C26H31ClF2N6O4 and a molecular weight of 565.02 g/mol. Its IUPAC name is N-[5-[[4-[[(3S,3aS,6aR)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-[4-(dimethylamino)piperidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-[[(3S,3aS,6aR)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-[4-(dimethylamino)piperidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170370268 |
| Molecular Formula | C26H31ClF2N6O4 |
| Molecular Weight | 565.02 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | N-[5-[[4-[[(3S,3aS,6aR)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]oxy]-5-chloropyrimidin-2-yl]amino]-2-[4-(dimethylamino)piperidin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(O[C@H]3CO[C@@H]4[C@H]3OCC4(F)F)n2)ccc1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C26H31ClF2N6O4/c1-4-21(36)32-18-11-15(5-6-19(18)35-9-7-16(8-10-35)34(2)3)31-25-30-12-17(27)24(33-25)39-20-13-37-23-22(20)38-14-26(23,28)29/h4-6,11-12,16,20,22-23H,1,7-10,13-14H2,2-3H3,(H,32,36)(H,30,31,33)/t20-,22-,23+/m0/s1 |
| InChIKey | KEGOAXKNZITOIC-ACIOBRDBSA-N |
| XLogP | 3.71 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.02 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|