C28H28FN7O — CID 122474774
N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 122474774) has the molecular formula C28H28FN7O and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474774 |
| Molecular Formula | C28H28FN7O |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3cccc(-c4cncc(F)c4)c3n2)ccc1N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C28H28FN7O/c1-4-26(37)33-24-13-21(8-9-25(24)36-11-10-22(17-36)35(2)3)32-28-31-15-18-6-5-7-23(27(18)34-28)19-12-20(29)16-30-14-19/h4-9,12-16,22H,1,10-11,17H2,2-3H3,(H,33,37)(H,31,32,34) |
| InChIKey | WAMJOMBWBYSMPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|