C29H29N5O — CID 152847029
N-[3-[2-[4-[[(3S)-1-methylpyrrolidin-3-yl]methyl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 152847029) has the molecular formula C29H29N5O and a molecular weight of 463.59 g/mol. Its IUPAC name is N-[3-[2-[4-[[(3S)-1-methylpyrrolidin-3-yl]methyl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-[[(3S)-1-methylpyrrolidin-3-yl]methyl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 152847029 |
| Molecular Formula | C29H29N5O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N-[3-[2-[4-[[(3S)-1-methylpyrrolidin-3-yl]methyl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cccc3cnc(Nc4ccc(C[C@H]5CCN(C)C5)cc4)nc23)c1 |
| InChI | InChI=1S/C29H29N5O/c1-3-27(35)31-25-8-4-6-22(17-25)26-9-5-7-23-18-30-29(33-28(23)26)32-24-12-10-20(11-13-24)16-21-14-15-34(2)19-21/h3-13,17-18,21H,1,14-16,19H2,2H3,(H,31,35)(H,30,32,33)/t21-/m1/s1 |
| InChIKey | TUIQOCFDAAEHLY-OAQYLSRUSA-N |
| XLogP | 5.66 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|