C30H31N7O2 — CID 123909291
N,1-dimethyl-4-[4-[[8-[3-(prop-2-enoylamino)phenyl]quinazolin-2-yl]amino]phenyl]piperazine-2-carboxamide (PubChem CID 123909291) has the molecular formula C30H31N7O2 and a molecular weight of 521.63 g/mol. Its IUPAC name is N,1-dimethyl-4-[4-[[8-[3-(prop-2-enoylamino)phenyl]quinazolin-2-yl]amino]phenyl]piperazine-2-carboxamide.
| Compound Name | N,1-dimethyl-4-[4-[[8-[3-(prop-2-enoylamino)phenyl]quinazolin-2-yl]amino]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 123909291 |
| Molecular Formula | C30H31N7O2 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | N,1-dimethyl-4-[4-[[8-[3-(prop-2-enoylamino)phenyl]quinazolin-2-yl]amino]phenyl]piperazine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cccc3cnc(Nc4ccc(N5CCN(C)C(C(=O)NC)C5)cc4)nc23)c1 |
| InChI | InChI=1S/C30H31N7O2/c1-4-27(38)33-23-9-5-7-20(17-23)25-10-6-8-21-18-32-30(35-28(21)25)34-22-11-13-24(14-12-22)37-16-15-36(3)26(19-37)29(39)31-2/h4-14,17-18,26H,1,15-16,19H2,2-3H3,(H,31,39)(H,33,38)(H,32,34,35) |
| InChIKey | NNHMUBOUUAUKNC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|