C28H26N8O — CID 140774294
N-[3-[2-[[5-isocyano-6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 140774294) has the molecular formula C28H26N8O and a molecular weight of 490.57 g/mol. Its IUPAC name is N-[3-[2-[[5-isocyano-6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[[5-isocyano-6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 140774294 |
| Molecular Formula | C28H26N8O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[3-[2-[[5-isocyano-6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | [C-]#[N+]c1cc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)cnc1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H26N8O/c1-4-25(37)32-21-9-5-7-19(15-21)23-10-6-8-20-17-31-28(34-26(20)23)33-22-16-24(29-2)27(30-18-22)36-13-11-35(3)12-14-36/h4-10,15-18H,1,11-14H2,3H3,(H,32,37)(H,31,33,34) |
| InChIKey | QQMRXLVAVUSJKG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|