C26H27N7OS — CID 58407985
N-[3-[2-[[3-methyl-5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]prop-2-enamide (PubChem CID 58407985) has the molecular formula C26H27N7OS and a molecular weight of 485.62 g/mol. Its IUPAC name is N-[3-[2-[[3-methyl-5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[[3-methyl-5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58407985 |
| Molecular Formula | C26H27N7OS |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[3-[2-[[3-methyl-5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]thieno[3,2-d]pyrimidin-7-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2csc3cnc(Nc4ncc(N5CCN(C)CC5)cc4C)nc23)c1 |
| InChI | InChI=1S/C26H27N7OS/c1-4-23(34)29-19-7-5-6-18(13-19)21-16-35-22-15-28-26(30-24(21)22)31-25-17(2)12-20(14-27-25)33-10-8-32(3)9-11-33/h4-7,12-16H,1,8-11H2,2-3H3,(H,29,34)(H,27,28,30,31) |
| InChIKey | HVEOCTKYQIMJIC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|