C25H28N6O2S2 — CID 90466261
N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide (PubChem CID 90466261) has the molecular formula C25H28N6O2S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90466261 |
| Molecular Formula | C25H28N6O2S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4scc(-c5cccc(NS(C)(=O)=O)c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C25H28N6O2S2/c1-3-30-11-13-31(14-12-30)21-9-7-19(8-10-21)27-25-26-16-23-24(28-25)22(17-34-23)18-5-4-6-20(15-18)29-35(2,32)33/h4-10,15-17,29H,3,11-14H2,1-2H3,(H,26,27,28) |
| InChIKey | MQMVBXQAIMTOTQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|