C24H26N6O3S — CID 175768601
N-[3-[4-deuterio-5-methyl-2-(4-morpholin-4-ylanilino)pyrrolo[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide (PubChem CID 175768601) has the molecular formula C24H26N6O3S and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[3-[4-deuterio-5-methyl-2-(4-morpholin-4-ylanilino)pyrrolo[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[4-deuterio-5-methyl-2-(4-morpholin-4-ylanilino)pyrrolo[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 175768601 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[3-[4-deuterio-5-methyl-2-(4-morpholin-4-ylanilino)pyrrolo[3,2-d]pyrimidin-7-yl]phenyl]methanesulfonamide |
| SMILES | [2H]c1nc(Nc2ccc(N3CCOCC3)cc2)nc2c(-c3cccc(NS(C)(=O)=O)c3)cn(C)c12 |
| InChI | InChI=1S/C24H26N6O3S/c1-29-16-21(17-4-3-5-19(14-17)28-34(2,31)32)23-22(29)15-25-24(27-23)26-18-6-8-20(9-7-18)30-10-12-33-13-11-30/h3-9,14-16,28H,10-13H2,1-2H3,(H,25,26,27)/i15D |
| InChIKey | JMYOXLDNKPWWEH-RWFJLFJASA-N |
| XLogP | 3.59 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|