C18H19FN6O — CID 117078807
5-fluoro-4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 117078807) has the molecular formula C18H19FN6O and a molecular weight of 354.39 g/mol. Its IUPAC name is 5-fluoro-4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 117078807 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 5-fluoro-4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | Cn1cc(-c2nc(Nc3ccc(N4CCOCC4)cc3)ncc2F)cn1 |
| InChI | InChI=1S/C18H19FN6O/c1-24-12-13(10-21-24)17-16(19)11-20-18(23-17)22-14-2-4-15(5-3-14)25-6-8-26-9-7-25/h2-5,10-12H,6-9H2,1H3,(H,20,22,23) |
| InChIKey | NVQJYCAXMMWTMW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|