C24H25F2N5O2 — CID 117077966
5-fluoro-4-(3-fluoro-5-morpholin-4-ylphenyl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 117077966) has the molecular formula C24H25F2N5O2 and a molecular weight of 453.49 g/mol. Its IUPAC name is 5-fluoro-4-(3-fluoro-5-morpholin-4-ylphenyl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(3-fluoro-5-morpholin-4-ylphenyl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 117077966 |
| Molecular Formula | C24H25F2N5O2 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 5-fluoro-4-(3-fluoro-5-morpholin-4-ylphenyl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | Fc1cc(-c2nc(Nc3ccc(N4CCOCC4)cc3)ncc2F)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C24H25F2N5O2/c25-18-13-17(14-21(15-18)31-7-11-33-12-8-31)23-22(26)16-27-24(29-23)28-19-1-3-20(4-2-19)30-5-9-32-10-6-30/h1-4,13-16H,5-12H2,(H,27,28,29) |
| InChIKey | DOTHLJMXVONIDQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|