C23H20F3N5O2 — CID 118361636
N-[2-fluoro-5-[5-fluoro-2-(4-fluoro-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118361636) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-[2-fluoro-5-[5-fluoro-2-(4-fluoro-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-fluoro-5-[5-fluoro-2-(4-fluoro-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361636 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[2-fluoro-5-[5-fluoro-2-(4-fluoro-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2nc(Nc3ccc(F)c(N4CCOCC4)c3)ncc2F)ccc1F |
| InChI | InChI=1S/C23H20F3N5O2/c1-2-21(32)29-19-11-14(3-5-16(19)24)22-18(26)13-27-23(30-22)28-15-4-6-17(25)20(12-15)31-7-9-33-10-8-31/h2-6,11-13H,1,7-10H2,(H,29,32)(H,27,28,30) |
| InChIKey | AUPNIBJFLQHJSZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|