C24H21F4N5O2 — CID 118361361
N-[3-[2-(4-fluoro-3-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118361361) has the molecular formula C24H21F4N5O2 and a molecular weight of 487.46 g/mol. Its IUPAC name is N-[3-[2-(4-fluoro-3-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-(4-fluoro-3-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361361 |
| Molecular Formula | C24H21F4N5O2 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[3-[2-(4-fluoro-3-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3ccc(F)c(N4CCOCC4)c3)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F4N5O2/c1-2-21(34)30-16-5-3-4-15(12-16)22-18(24(26,27)28)14-29-23(32-22)31-17-6-7-19(25)20(13-17)33-8-10-35-11-9-33/h2-7,12-14H,1,8-11H2,(H,30,34)(H,29,31,32) |
| InChIKey | OVVLPRSHKCYNHR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|