C23H22ClN5O3 — CID 118361445
N-[3-[5-chloro-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118361445) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is N-[3-[5-chloro-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[5-chloro-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361445 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[3-[5-chloro-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3ccc(O)c(N4CCOCC4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C23H22ClN5O3/c1-2-21(31)26-16-5-3-4-15(12-16)22-18(24)14-25-23(28-22)27-17-6-7-20(30)19(13-17)29-8-10-32-11-9-29/h2-7,12-14,30H,1,8-11H2,(H,26,31)(H,25,27,28) |
| InChIKey | NHKLOCZPLZWUHN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|