C29H34ClN5O10P2 — CID 144601968
[3-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-(3-morpholin-4-ylpropoxy)phenoxy]-1-dihydroxyphosphanyl-3-oxopropyl]phosphonic acid (PubChem CID 144601968) has the molecular formula C29H34ClN5O10P2 and a molecular weight of 710.02 g/mol. Its IUPAC name is [3-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-(3-morpholin-4-ylpropoxy)phenoxy]-1-dihydroxyphosphanyl-3-oxopropyl]phosphonic acid.
| Compound Name | [3-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-(3-morpholin-4-ylpropoxy)phenoxy]-1-dihydroxyphosphanyl-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 144601968 |
| Molecular Formula | C29H34ClN5O10P2 |
| Molecular Weight | 710.02 g/mol |
| Exact Mass | 709.15 |
| IUPAC Name | [3-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-(3-morpholin-4-ylpropoxy)phenoxy]-1-dihydroxyphosphanyl-3-oxopropyl]phosphonic acid |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3ccc(OC(=O)CC(P(O)O)P(=O)(O)O)c(OCCCN4CCOCC4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C29H34ClN5O10P2/c1-2-25(36)32-20-6-3-5-19(15-20)28-22(30)18-31-29(34-28)33-21-7-8-23(45-26(37)17-27(46(38)39)47(40,41)42)24(16-21)44-12-4-9-35-10-13-43-14-11-35/h2-3,5-8,15-16,18,27,38-39H,1,4,9-14,17H2,(H,32,36)(H,31,33,34)(H2,40,41,42) |
| InChIKey | LXGIDEBQHBPFHJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 212.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|