C28H33ClN5O6P — CID 118361676
[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-[3-(4-methylpiperidin-1-yl)propoxy]phenyl] dihydrogen phosphate (PubChem CID 118361676) has the molecular formula C28H33ClN5O6P and a molecular weight of 602.03 g/mol. Its IUPAC name is [4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-[3-(4-methylpiperidin-1-yl)propoxy]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-[3-(4-methylpiperidin-1-yl)propoxy]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118361676 |
| Molecular Formula | C28H33ClN5O6P |
| Molecular Weight | 602.03 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | [4-[[5-chloro-4-[3-(prop-2-enoylamino)phenyl]pyrimidin-2-yl]amino]-2-[3-(4-methylpiperidin-1-yl)propoxy]phenyl] dihydrogen phosphate |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3ccc(OP(=O)(O)O)c(OCCCN4CCC(C)CC4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C28H33ClN5O6P/c1-3-26(35)31-21-7-4-6-20(16-21)27-23(29)18-30-28(33-27)32-22-8-9-24(40-41(36,37)38)25(17-22)39-15-5-12-34-13-10-19(2)11-14-34/h3-4,6-9,16-19H,1,5,10-15H2,2H3,(H,31,35)(H,30,32,33)(H2,36,37,38) |
| InChIKey | CFGJTKZGVUQYLZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.03 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|