C24H24ClN4O6P — CID 161067817
[4-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate (PubChem CID 161067817) has the molecular formula C24H24ClN4O6P and a molecular weight of 530.91 g/mol. Its IUPAC name is [4-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate.
| Compound Name | [4-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 161067817 |
| Molecular Formula | C24H24ClN4O6P |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | [4-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl] dihydrogen phosphate |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3ccc(OP(=O)(O)O)c(N4CCOCC4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C24H24ClN4O6P/c1-2-19(30)13-16-4-3-5-17(12-16)23-20(25)15-26-24(28-23)27-18-6-7-22(35-36(31,32)33)21(14-18)29-8-10-34-11-9-29/h2-7,12,14-15H,1,8-11,13H2,(H,26,27,28)(H2,31,32,33) |
| InChIKey | GAOKGZYBBODMGO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|