C28H31ClFN5O9P2 — CID 157201237
[3-[5-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-3-fluoro-2-(4-methylpiperazin-1-yl)phenoxy]-3-oxo-1-phosphonopropyl]phosphonic acid (PubChem CID 157201237) has the molecular formula C28H31ClFN5O9P2 and a molecular weight of 697.98 g/mol. Its IUPAC name is [3-[5-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-3-fluoro-2-(4-methylpiperazin-1-yl)phenoxy]-3-oxo-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[5-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-3-fluoro-2-(4-methylpiperazin-1-yl)phenoxy]-3-oxo-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 157201237 |
| Molecular Formula | C28H31ClFN5O9P2 |
| Molecular Weight | 697.98 g/mol |
| Exact Mass | 697.13 |
| IUPAC Name | [3-[5-[[5-chloro-4-[3-(2-oxobut-3-enyl)phenyl]pyrimidin-2-yl]amino]-3-fluoro-2-(4-methylpiperazin-1-yl)phenoxy]-3-oxo-1-phosphonopropyl]phosphonic acid |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cc(F)c(N4CCN(C)CC4)c(OC(=O)CC(P(=O)(O)O)P(=O)(O)O)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C28H31ClFN5O9P2/c1-3-20(36)12-17-5-4-6-18(11-17)26-21(29)16-31-28(33-26)32-19-13-22(30)27(35-9-7-34(2)8-10-35)23(14-19)44-24(37)15-25(45(38,39)40)46(41,42)43/h3-6,11,13-14,16,25H,1,7-10,12,15H2,2H3,(H,31,32,33)(H2,38,39,40)(H2,41,42,43) |
| InChIKey | NGISXGSTCOCLOR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 202.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|