C26H26ClF2N5O2 — CID 160628211
1-[3-[[[5-chloro-2-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one (PubChem CID 160628211) has the molecular formula C26H26ClF2N5O2 and a molecular weight of 513.98 g/mol. Its IUPAC name is 1-[3-[[[5-chloro-2-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[[[5-chloro-2-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 160628211 |
| Molecular Formula | C26H26ClF2N5O2 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 1-[3-[[[5-chloro-2-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(CNc2nc(Nc3cc(F)c(N4CCC(O)CC4)c(F)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C26H26ClF2N5O2/c1-2-19(35)11-16-4-3-5-17(10-16)14-30-25-21(27)15-31-26(33-25)32-18-12-22(28)24(23(29)13-18)34-8-6-20(36)7-9-34/h2-5,10,12-13,15,20,36H,1,6-9,11,14H2,(H2,30,31,32,33) |
| InChIKey | RHOUFOCGZCPBHU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|