C19H18ClFN6O — CID 157131795
1-[5-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]-2-fluorophenyl]but-3-en-2-one (PubChem CID 157131795) has the molecular formula C19H18ClFN6O and a molecular weight of 400.85 g/mol. Its IUPAC name is 1-[5-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]-2-fluorophenyl]but-3-en-2-one.
| Compound Name | 1-[5-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]-2-fluorophenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157131795 |
| Molecular Formula | C19H18ClFN6O |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-[5-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]-2-fluorophenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(CNc2nc(Nc3cnn(C)c3)ncc2Cl)ccc1F |
| InChI | InChI=1S/C19H18ClFN6O/c1-3-15(28)7-13-6-12(4-5-17(13)21)8-22-18-16(20)10-23-19(26-18)25-14-9-24-27(2)11-14/h3-6,9-11H,1,7-8H2,2H3,(H2,22,23,25,26) |
| InChIKey | KSRIVKAIIBSVCA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|