C17H14ClF2N7O — CID 163281014
N-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluorophenyl]-2-fluoroprop-2-enamide (PubChem CID 163281014) has the molecular formula C17H14ClF2N7O and a molecular weight of 405.80 g/mol. Its IUPAC name is N-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluorophenyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluorophenyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 163281014 |
| Molecular Formula | C17H14ClF2N7O |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluorophenyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1ccc(F)c(Nc2nc(Nc3cnn(C)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C17H14ClF2N7O/c1-9(19)16(28)23-10-3-4-13(20)14(5-10)25-15-12(18)7-21-17(26-15)24-11-6-22-27(2)8-11/h3-8H,1H2,2H3,(H,23,28)(H2,21,24,25,26) |
| InChIKey | VXXRKGJZJQAULP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|