C24H21ClN8O2 — CID 163280829
2-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-N-phenyl-4-(prop-2-enoylamino)benzamide (PubChem CID 163280829) has the molecular formula C24H21ClN8O2 and a molecular weight of 488.94 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-N-phenyl-4-(prop-2-enoylamino)benzamide.
| Compound Name | 2-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-N-phenyl-4-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 163280829 |
| Molecular Formula | C24H21ClN8O2 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-N-phenyl-4-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Nc2ccccc2)c(Nc2nc(Nc3cnn(C)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C24H21ClN8O2/c1-3-21(34)28-16-9-10-18(23(35)29-15-7-5-4-6-8-15)20(11-16)31-22-19(25)13-26-24(32-22)30-17-12-27-33(2)14-17/h3-14H,1H2,2H3,(H,28,34)(H,29,35)(H2,26,30,31,32) |
| InChIKey | DPKFBEISCZSMPY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 125.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|