C22H24ClN5O2P+ — CID 71470478
[2-[[5-chloro-2-[2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]phenyl]-hydroxy-dimethylphosphanium (PubChem CID 71470478) has the molecular formula C22H24ClN5O2P+ and a molecular weight of 456.89 g/mol. Its IUPAC name is [2-[[5-chloro-2-[2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]phenyl]-hydroxy-dimethylphosphanium.
| Compound Name | [2-[[5-chloro-2-[2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]phenyl]-hydroxy-dimethylphosphanium |
|---|---|
| PubChem CID | 71470478 |
| Molecular Formula | C22H24ClN5O2P+ |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [2-[[5-chloro-2-[2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]phenyl]-hydroxy-dimethylphosphanium |
| SMILES | C=CC(=O)Nc1ccc(C)c(Nc2ncc(Cl)c(Nc3ccccc3[P+](C)(C)O)n2)c1 |
| InChI | InChI=1S/C22H23ClN5O2P/c1-5-20(29)25-15-11-10-14(2)18(12-15)27-22-24-13-16(23)21(28-22)26-17-8-6-7-9-19(17)31(3,4)30/h5-13,30H,1H2,2-4H3,(H2-,24,25,26,27,28,29)/p+1 |
| InChIKey | AYAOPGUFBPVYDN-UHFFFAOYSA-O |
| XLogP | 4.86 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|