C22H21ClN6O2 — CID 90330992
3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-ethylbenzamide (PubChem CID 90330992) has the molecular formula C22H21ClN6O2 and a molecular weight of 436.90 g/mol. Its IUPAC name is 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-ethylbenzamide.
| Compound Name | 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-ethylbenzamide |
|---|---|
| PubChem CID | 90330992 |
| Molecular Formula | C22H21ClN6O2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-ethylbenzamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2cc(C(N)=O)ccc2CC)ncc1Cl |
| InChI | InChI=1S/C22H21ClN6O2/c1-3-13-9-10-14(20(24)31)11-18(13)28-22-25-12-15(23)21(29-22)27-17-8-6-5-7-16(17)26-19(30)4-2/h4-12H,2-3H2,1H3,(H2,24,31)(H,26,30)(H2,25,27,28,29) |
| InChIKey | CUAWXRHWQWQWTF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|