C21H25ClN6O2 — CID 90331101
3-[[5-chloro-4-[[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide (PubChem CID 90331101) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 3-[[5-chloro-4-[[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide.
| Compound Name | 3-[[5-chloro-4-[[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 90331101 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-[[5-chloro-4-[[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1Nc1nc(Nc2cc(C(N)=O)ccc2C)ncc1Cl |
| InChI | InChI=1S/C21H25ClN6O2/c1-3-18(29)25-15-6-4-5-7-16(15)26-20-14(22)11-24-21(28-20)27-17-10-13(19(23)30)9-8-12(17)2/h3,8-11,15-16H,1,4-7H2,2H3,(H2,23,30)(H,25,29)(H2,24,26,27,28)/t15-,16+/m0/s1 |
| InChIKey | XCFZEEAABFYNEX-JKSUJKDBSA-N |
| XLogP | 3.31 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|