C22H20ClN5O2 — CID 158185750
3-[[5-chloro-4-[4-methyl-2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]benzamide (PubChem CID 158185750) has the molecular formula C22H20ClN5O2 and a molecular weight of 421.89 g/mol. Its IUPAC name is 3-[[5-chloro-4-[4-methyl-2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]benzamide.
| Compound Name | 3-[[5-chloro-4-[4-methyl-2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 158185750 |
| Molecular Formula | C22H20ClN5O2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-[[5-chloro-4-[4-methyl-2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]benzamide |
| SMILES | C=CC(=O)Cc1cc(C)ccc1Nc1nc(Nc2cccc(C(N)=O)c2)ncc1Cl |
| InChI | InChI=1S/C22H20ClN5O2/c1-3-17(29)11-15-9-13(2)7-8-19(15)27-21-18(23)12-25-22(28-21)26-16-6-4-5-14(10-16)20(24)30/h3-10,12H,1,11H2,2H3,(H2,24,30)(H2,25,26,27,28) |
| InChIKey | VBGMPAHLOXXCLB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|