C26H29ClN6O — CID 167699496
1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one (PubChem CID 167699496) has the molecular formula C26H29ClN6O and a molecular weight of 477.01 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167699496 |
| Molecular Formula | C26H29ClN6O |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(C)ccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C26H29ClN6O/c1-4-22(34)16-19-15-18(2)5-10-24(19)30-25-23(27)17-28-26(31-25)29-20-6-8-21(9-7-20)33-13-11-32(3)12-14-33/h4-10,15,17H,1,11-14,16H2,2-3H3,(H2,28,29,30,31) |
| InChIKey | YDUQCLHANSNBET-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|