C27H35N7O2S — CID 67207259
N-[3-ethyl-4-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide (PubChem CID 67207259) has the molecular formula C27H35N7O2S and a molecular weight of 521.69 g/mol. Its IUPAC name is N-[3-ethyl-4-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide.
| Compound Name | N-[3-ethyl-4-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 67207259 |
| Molecular Formula | C27H35N7O2S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N-[3-ethyl-4-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide |
| SMILES | CCc1cc(NS(=O)(=O)C2CC2)ccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C |
| InChI | InChI=1S/C27H35N7O2S/c1-4-20-17-22(32-37(35,36)24-10-11-24)7-12-25(20)30-26-19(2)18-28-27(31-26)29-21-5-8-23(9-6-21)34-15-13-33(3)14-16-34/h5-9,12,17-18,24,32H,4,10-11,13-16H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | WLSBPMLCYSOPSZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|