C25H30ClN7O2S — CID 140802738
N-[5-chloro-2-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide (PubChem CID 140802738) has the molecular formula C25H30ClN7O2S and a molecular weight of 528.08 g/mol. Its IUPAC name is N-[5-chloro-2-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide.
| Compound Name | N-[5-chloro-2-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 140802738 |
| Molecular Formula | C25H30ClN7O2S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-[5-chloro-2-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1ccc(Cl)cc1NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C25H30ClN7O2S/c1-17-16-27-25(28-19-4-6-20(7-5-19)33-13-11-32(2)12-14-33)30-24(17)29-22-10-3-18(26)15-23(22)31-36(34,35)21-8-9-21/h3-7,10,15-16,21,31H,8-9,11-14H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | YBJXFRYKOWQSFO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|