C26H34BrN7O2S — CID 118280079
3-bromo-N-tert-butyl-5-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 118280079) has the molecular formula C26H34BrN7O2S and a molecular weight of 588.58 g/mol. Its IUPAC name is 3-bromo-N-tert-butyl-5-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | 3-bromo-N-tert-butyl-5-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 118280079 |
| Molecular Formula | C26H34BrN7O2S |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 3-bromo-N-tert-butyl-5-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cc(Br)cc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C26H34BrN7O2S/c1-18-17-28-25(30-20-6-8-22(9-7-20)34-12-10-33(5)11-13-34)31-24(18)29-21-14-19(27)15-23(16-21)37(35,36)32-26(2,3)4/h6-9,14-17,32H,10-13H2,1-5H3,(H2,28,29,30,31) |
| InChIKey | GBXSMNBUPCMGFT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|