C25H33N7O2S — CID 16722938
3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide (PubChem CID 16722938) has the molecular formula C25H33N7O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 16722938 |
| Molecular Formula | C25H33N7O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cccc(S(=O)(=O)NC(C)C)c1 |
| InChI | InChI=1S/C25H33N7O2S/c1-18(2)30-35(33,34)23-7-5-6-21(16-23)27-24-19(3)17-26-25(29-24)28-20-8-10-22(11-9-20)32-14-12-31(4)13-15-32/h5-11,16-18,30H,12-15H2,1-4H3,(H2,26,27,28,29) |
| InChIKey | XFBLKGPSFMLRFU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|